Sideroxylin structure
|
Common Name | Sideroxylin | ||
|---|---|---|---|---|
| CAS Number | 3122-87-0 | Molecular Weight | 312.317 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 565.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3±23.6 °C | |
Use of SideroxylinSideroxylin is a C-methylated flavone isolated from Callistemon lanceolatus and exerts antimicrobial activity against Staphylococcus aureus. Sideroxylin inhibits ovarian cancer cell proliferation and induces apoptosis, causing DNA fragmentation, depolarization of the mitochondrial membrane, the generation of reactive oxygen species (ROS)[1]. |
| Name | 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6,8-dimethylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Sideroxylin is a C-methylated flavone isolated from Callistemon lanceolatus and exerts antimicrobial activity against Staphylococcus aureus. Sideroxylin inhibits ovarian cancer cell proliferation and induces apoptosis, causing DNA fragmentation, depolarization of the mitochondrial membrane, the generation of reactive oxygen species (ROS)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 565.5±50.0 °C at 760 mmHg |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.317 |
| Flash Point | 210.3±23.6 °C |
| Exact Mass | 312.099762 |
| PSA | 79.90000 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | QJSQOGJCHBXLAH-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4',5-Dihydroxy-7-methoxy-6,8-dimethylflavone |
| 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6,8-dimethyl-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6,8-dimethyl- |
| 5,4'-dihydroxy-7-methoxy-6,8-dimethylflavone |
| sideroxyline |
| 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6,8-dimethyl-4H-1-benzopyran-4-one |
| sideroxylin |