(4-nitrophenyl)methoxyurea structure
|
Common Name | (4-nitrophenyl)methoxyurea | ||
|---|---|---|---|---|
| CAS Number | 31150-87-5 | Molecular Weight | 211.17500 | |
| Density | 1.407g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl)methoxyurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.17500 |
| Exact Mass | 211.05900 |
| PSA | 110.17000 |
| LogP | 2.30910 |
| Index of Refraction | 1.598 |
| InChIKey | NIRQVZUQDNTANO-UHFFFAOYSA-N |
| SMILES | NC(=O)NOCc1ccc([N+](=O)[O-])cc1 |
|
~%
(4-nitrophenyl)... CAS#:31150-87-5 |
| Literature: Hamor; Breslow; Fisch Journal of pharmaceutical sciences, 1970 , vol. 59, # 12 p. 1752 - 1756 |
|
~%
(4-nitrophenyl)... CAS#:31150-87-5 |
| Literature: Brady; Klein Journal of the Chemical Society, 1927 , p. 882 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-Nitrobenzyloxy-harnstoff |