(4-nitrophenyl) pyrazine-2-carboxylate
Modify Date: 2025-11-30 17:42:52
(4-nitrophenyl) pyrazine-2-carboxylate structure
|
Common Name | (4-nitrophenyl) pyrazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 20088-23-7 | Molecular Weight | 245.19100 | |
| Density | 1.432g/cm3 | Boiling Point | 437.4ºC at 760 mmHg | |
| Molecular Formula | C11H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.3ºC | |
| Name | (4-nitrophenyl) pyrazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 437.4ºC at 760 mmHg |
| Molecular Formula | C11H7N3O4 |
| Molecular Weight | 245.19100 |
| Flash Point | 218.3ºC |
| Exact Mass | 245.04400 |
| PSA | 97.90000 |
| LogP | 2.12720 |
| Vapour Pressure | 7.53E-08mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | BCDUISSCCYHFOP-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1cnccn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitrophenyl pyrazinoate |
| Pyrazinecarboxylic acid,p-nitrophenyl ester |