2-Mesityl-2-oxoacetic acid structure
|
Common Name | 2-Mesityl-2-oxoacetic acid | ||
|---|---|---|---|---|
| CAS Number | 3112-46-7 | Molecular Weight | 192.21100 | |
| Density | 1.169g/cm3 | Boiling Point | 339.9ºC at 760mmHg | |
| Molecular Formula | C11H12O3 | Melting Point | 123-124ºC | |
| MSDS | USA | Flash Point | 173.5ºC | |
| Name | 2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 339.9ºC at 760mmHg |
| Melting Point | 123-124ºC |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21100 |
| Flash Point | 173.5ºC |
| Exact Mass | 192.07900 |
| PSA | 54.37000 |
| LogP | 1.87910 |
| Index of Refraction | 1.549 |
| InChIKey | IRSQOXNQMAUSTG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)C(=O)O)c(C)c1 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00151834 |
| mesitylglyoxylic acid |
| 2,4,6-trimethylbenzoylformic acid |
| mesiylglyoxylic acid |
| mesitoyl formic acid |
| Mesityl-glyoxylsaeure |