Perfluorohexanoic acid structure
|
Common Name | Perfluorohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 307-24-4 | Molecular Weight | 314.053 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 143.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C6HF11O2 | Melting Point | 14 °C | |
| MSDS | Chinese USA | Flash Point | 40.3±25.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | perfluorohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 143.0±35.0 °C at 760 mmHg |
| Melting Point | 14 °C |
| Molecular Formula | C6HF11O2 |
| Molecular Weight | 314.053 |
| Flash Point | 40.3±25.9 °C |
| Exact Mass | 313.980103 |
| PSA | 37.30000 |
| LogP | 5.97 |
| Vapour Pressure | 3.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.290 |
| InChIKey | PXUULQAPEKKVAH-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Stability | Stable, but may be light sensitive. Incompatible with oxidizing agents. |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2915900090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Occurrence of perfluorinated alkyl substances in sediment from estuarine and coastal areas of the East China Sea.
Environ. Sci. Pollut. Res. Int. 22(3) , 1662-9, (2015) Perfluorinated alkyl substances (PFAS) have drawn much attention due to their environmental persistence, ubiquitous existence, and bioaccumulation potential. The occurrence and spatial variation of PF... |
|
|
Determination of perfluorinated alkyl acids in corn, popcorn and popcorn bags before and after cooking by focused ultrasound solid-liquid extraction, liquid chromatography and quadrupole-time of flight mass spectrometry.
J. Chromatogr. A. 1355 , 211-8, (2014) An analytical method is proposed to determine ten perfluorinated alkyl acids (PFAAs) [nine perfluorocarboxylic acids (PFCAs) and perfluorooctane sulfonate (PFOS)] in corn, popcorn and microwave popcor... |
|
|
Chemometric strategy for untargeted lipidomics: biomarker detection and identification in stressed human placental cells.
Anal. Chim. Acta 854 , 20-33, (2014) A lipidomic study was developed in a human placental choriocarcinoma cell line (JEG-3) exposed to tributyltin (TBT) and to a mixture of perfluorinated chemicals (PFCs). The method was based on the app... |
| Perfluorohexanoic acid (PFHXA) |
| Undecafluoro-1-hexanoic acid |
| perfluoro-1-hexanoic acid |
| 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoic acid |
| MFCD00198040 |
| Hexanoic acid, undecafluoro- |
| Undecafluor-hexansaeure |
| IPC-PFFA-6 |
| nonafluoropentanoic acid |
| Hexanoic acid,undecafluoro |
| Hexanoic acid,perfluoro |
| Undecafluorohexanoic acid |
| Perfluorohexanoic acid |
| perfluorocaproic acid |
| EINECS 206-196-6 |
| Hexanoic acid, 2,2,3,3,4,4,5,5,6,6,6-undecafluoro- |
| IPC-PFFA-6 HG |