4H-1,2,4-Triazol-4-amine,3,5-diphenyl- structure
|
Common Name | 4H-1,2,4-Triazol-4-amine,3,5-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 3049-45-4 | Molecular Weight | 236.27200 | |
| Density | 1.24g/cm3 | Boiling Point | 471.4ºC at 760mmHg | |
| Molecular Formula | C14H12N4 | Melting Point | 255-258ºC | |
| MSDS | N/A | Flash Point | 238.9ºC | |
| Name | 3,5-diphenyl-1,2,4-triazol-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 471.4ºC at 760mmHg |
| Melting Point | 255-258ºC |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.27200 |
| Flash Point | 238.9ºC |
| Exact Mass | 236.10600 |
| PSA | 56.73000 |
| LogP | 2.90710 |
| Index of Refraction | 1.677 |
| InChIKey | DAZAXBYJPXKJJL-UHFFFAOYSA-N |
| SMILES | Nn1c(-c2ccccc2)nnc1-c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-Diphenyl-[1,2,4]triazol-4-ylamine |
| 4-Amino-3.5-diphenyl-1.2.4-triazol |
| 3,5-diphenyl-4-amino-1,2,4-triazole |
| 3,5-diphenyl-1,2,4-triazole-4-ylamine |
| 4-amino-3,5-diphenyl-4H-1,2,4-triazole |
| 3,5-Diphenyl-[1,2,4]triazol-4-ylamin |
| 3,5-Diphenyl-4H-1,2,4-triazol-4-amine |
| 4-amino-3,5-diphenyl-1,2,4-triazole |
| amino-4 diphenyl-3,5 triazole-1,2,4 |
| diphenyltriazolamine |