4'-METHOXYFLAVANONE structure
|
Common Name | 4'-METHOXYFLAVANONE | ||
|---|---|---|---|---|
| CAS Number | 3034-08-0 | Molecular Weight | 254.28100 | |
| Density | 1.199g/cm3 | Boiling Point | 421.8ºC at 760mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 92-94ºC | |
| MSDS | N/A | Flash Point | 200.7ºC | |
| Name | (2S)-2-(4-Methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760mmHg |
| Melting Point | 92-94ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 200.7ºC |
| Exact Mass | 254.09400 |
| PSA | 35.53000 |
| LogP | 3.40170 |
| Index of Refraction | 1.587 |
| InChIKey | QIUYUYOXCGBABP-INIZCTEOSA-N |
| SMILES | COc1ccc(C2CC(=O)c3ccccc3O2)cc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| METHOXYFLAVANONE,4' |
| 2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| 2,3-dihydro-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| 2-(4-methoxyphenyl)-4-chromanone |
| 2-(4'-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| 2,3-dihydro-2-(4-methoxyphenyl)chromen-4-one |
| 2-(4-methoxyphenyl)chroman-4-one |