4'-Methoxyflavone structure
|
Common Name | 4'-Methoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 4143-74-2 | Molecular Weight | 252.26500 | |
| Density | 1.24 g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | 157-158ºC | |
| MSDS | USA | Flash Point | 188.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Melting Point | 157-158ºC |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 188.2ºC |
| Exact Mass | 252.07900 |
| PSA | 39.44000 |
| LogP | 3.46860 |
| Index of Refraction | 1.614 |
| InChIKey | OMICQBVLCVRFGN-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3ccccc3o2)cc1 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Flavonoids as a scaffold for development of novel anti-angiogenic agents: An experimental and computational enquiry.
Arch. Biochem. Biophys. 577-578 , 35-48, (2015) Relationship between structural diversity and biological activities of flavonoids has remained an important discourse in the mainstream of flavonoid research. In the current study anti-angiogenic, cyt... |
| 4'-Methoxyflavone |
| 4' methoxyflavone |