4,4',4''-TRIMETHOXYTRITYL ALCOHOL structure
|
Common Name | 4,4',4''-TRIMETHOXYTRITYL ALCOHOL | ||
|---|---|---|---|---|
| CAS Number | 3010-81-9 | Molecular Weight | 350.40800 | |
| Density | 1.159g/cm3 | Boiling Point | 522.1ºC at 760mmHg | |
| Molecular Formula | C22H22O4 | Melting Point | 76-77ºC | |
| MSDS | N/A | Flash Point | 269.6ºC | |
| Name | tris(4-methoxyphenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 522.1ºC at 760mmHg |
| Melting Point | 76-77ºC |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.40800 |
| Flash Point | 269.6ºC |
| Exact Mass | 350.15200 |
| PSA | 47.92000 |
| LogP | 3.99660 |
| Index of Refraction | 1.583 |
| InChIKey | JCLOLVVCZNYDIP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2909499000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Hydroxy-tris-(4-methoxy-phenyl)-methan |
| Tris(4-methoxyphenyl)methanol |
| tri(4-methoxyphenyl)methanol |
| 4,4',4''-trimethoxytrityl alcohol |
| EINECS 221-139-5 |
| tri(p-anisyl)methanol |
| Tris-(4-methoxy-phenyl)-methanol |
| tri(4-methoxyphenyl)carbinol |