(1-ethoxy-1-oxopropan-2-yl)-triphenylphosphanium,bromide structure
|
Common Name | (1-ethoxy-1-oxopropan-2-yl)-triphenylphosphanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 30018-16-7 | Molecular Weight | 443.313 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24BrO2P | Melting Point | 152 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-ethoxy-1-oxopropan-2-yl)-triphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 152 °C |
|---|---|
| Molecular Formula | C23H24BrO2P |
| Molecular Weight | 443.313 |
| Exact Mass | 442.069733 |
| PSA | 39.89000 |
| LogP | 0.93610 |
| InChIKey | RSYXORMKBUFAMS-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Storage condition | Refrigerator (+4°C) |
| Water Solubility | soluble |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R29;R36/37/38 |
| Safety Phrases | S26-S36-S8-S37/39 |
| HS Code | 2931900090 |
|
~98%
(1-ethoxy-1-oxo... CAS#:30018-16-7 |
| Literature: Denmark, Scott E.; Kobayashi, Tetsuya; Regens, Christopher S. Tetrahedron, 2010 , vol. 66, # 26 p. 4745 - 4759 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (1-(ETHOXYCARBONYL)ETHYL)TRIPHENYLPHOSPHONIUM BROMIDE |
| CEETPPB |
| (1-Ethoxy-1-oxopropan-2-yl)(triphenyl)phosphonium bromide |
| EINECS 250-002-2 |
| MFCD00031605 |
| (1-Ethoxy-1-oxo-2-propanyl)(triphenyl)phosphonium bromide |
| [1-(Ethoxycarbonyl)Ethyl]Triphenylphosphonium Bromide |
| (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide |
| Phosphonium, (2-ethoxy-1-methyl-2-oxoethyl)triphenyl-, bromide (1:1) |
| carbethoxy ethyl triphenyl phosphonium bromide |
| 1-(Ethoxycarbonyl)ethyltriphenyl phosphonium bromide |