2,6-Dinitro-4-methyl anisole structure
|
Common Name | 2,6-Dinitro-4-methyl anisole | ||
|---|---|---|---|---|
| CAS Number | 29455-11-6 | Molecular Weight | 212.16000 | |
| Density | 1.383 g/cm3 | Boiling Point | 368.9ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O5 | Melting Point | 123-125ºC | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | 2-methoxy-5-methyl-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383 g/cm3 |
|---|---|
| Boiling Point | 368.9ºC at 760 mmHg |
| Melting Point | 123-125ºC |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16000 |
| Flash Point | 182.9ºC |
| Exact Mass | 212.04300 |
| PSA | 100.87000 |
| LogP | 2.86640 |
| Vapour Pressure | 2.62E-05mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | HVNUPXQONRHUOX-UHFFFAOYSA-N |
| SMILES | COc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Methoxy-3,5-dinitrotoluene |
| 2,6-dinitro-4-methylanisole |
| 4-METHOXY-3,5-DINITROTOLUENE |
| 1-Methoxy-4-methyl-2,6-dinitrobenzene |
| 2,5-DIMETHYL-1-[3-(METHYLTHIO)PHENYL]-1H-PYRROLE-3-CARBALDEHYDE |
| 4-Methyl-2,6-dinitro-anisol |
| 3.5-Dinitro-4-methoxy-toluol |
| 2,6-Dinitro-4-methylanisole |
| Methyl-(2.6-dinitro-4-methyl-phenyl)-aether |
| 4-methyl-2,6-dinitro-anisole |
| 4-Methyl-2,6-dinitroanisole |