2-(4-methylphenyl)-1,3-dinitrobenzene
Modify Date: 2025-11-05 15:09:10
2-(4-methylphenyl)-1,3-dinitrobenzene structure
|
Common Name | 2-(4-methylphenyl)-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 23621-60-5 | Molecular Weight | 258.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylphenyl)-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N2O4 |
|---|---|
| Molecular Weight | 258.22900 |
| Exact Mass | 258.06400 |
| PSA | 91.64000 |
| LogP | 4.52480 |
| InChIKey | UKNFKMQHTFOMOY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2c([N+](=O)[O-])cccc2[N+](=O)[O-])cc1 |
|
~%
2-(4-methylphen... CAS#:23621-60-5 |
| Literature: Forrest,J. Journal of the Chemical Society, 1960 , p. 574 - 580 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2',6'-Dinitro-4-methylbiphenyl |
| 1,1'-Biphenyl,4'-methyl-2,6-dinitro |
| 4-Methyl-2'.6'-dinitro-biphenyl |