Lasiodin structure
|
Common Name | Lasiodin | ||
|---|---|---|---|---|
| CAS Number | 28957-08-6 | Molecular Weight | 406.47 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 588.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H30O7 | Melting Point | 238-239℃ | |
| MSDS | N/A | Flash Point | 203.8±23.6 °C | |
Use of LasiodinLasiokaurin is a diterpenoid compound isolated from Isodon lasiocarpus[1]. |
| Name | Lasiokaurin |
|---|---|
| Synonym | More Synonyms |
| Description | Lasiokaurin is a diterpenoid compound isolated from Isodon lasiocarpus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 588.0±50.0 °C at 760 mmHg |
| Melting Point | 238-239℃ |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.47 |
| Flash Point | 203.8±23.6 °C |
| Exact Mass | 406.199158 |
| PSA | 113.29000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | DJQLJZNVICMJRV-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)C23C(O)C1CCC2C12COC3(O)C(O)C1C(C)(C)CCC2OC(C)=O |
| Hazard Codes | Xi |
|---|
| 6,7,14-Trihydroxy-15-oxo-7,20-epoxykaur-16-en-1-yl acetate |