2,6-Pyridinedicarbonitrile structure
|
Common Name | 2,6-Pyridinedicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 2893-33-6 | Molecular Weight | 129.11900 | |
| Density | 1.25g/cm3 | Boiling Point | 290ºC at 760mmHg | |
| Molecular Formula | C7H3N3 | Melting Point | 123-127ºC | |
| MSDS | Chinese USA | Flash Point | 107.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | pyridine-2,6-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 290ºC at 760mmHg |
| Melting Point | 123-127ºC |
| Molecular Formula | C7H3N3 |
| Molecular Weight | 129.11900 |
| Flash Point | 107.2ºC |
| Exact Mass | 129.03300 |
| PSA | 60.47000 |
| LogP | 0.82496 |
| Vapour Pressure | 0.00213mmHg at 25°C |
| Index of Refraction | 1.567 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Biotransformation of heterocyclic dinitriles by Rhodococcus erythropolis and fungal nitrilases.
Biotechnol. Lett. 29(7) , 1119-24, (2007) 2,6-Pyridinedicarbonitrile (1a) and 2,4-pyridinedicarbonitrile (2a) were hydrated by Rhodococcus erythropolis A4 to 6-cyanopyridine-2-carboxamide (1b; 83% yield) and 2-cyanopyridine-4-carboxamide (2b;... |
|
|
Synthesis and characterisation of macrocycles containing both tetrazole and pyridine functionalities. Fleming A, et al.
Tetrahedron 67(18) , 3260-3266, (2011)
|
|
|
Synthesis and exploratory coordination chemistry of the new ditertiary carbinamine ligand 2, 6-bis (a-aminoisopropyl) pyridine. Dahlenburg L, et al.
Inorganica Chim. Acta 360(5) , 1474-1481, (2007)
|
| pyridine-2,6-dinitrile |
| 2,5-DIMETHYL-3-FUROIC ACID |
| pyridin-2,6-dicarbonitril |
| XNPMXMIWHVZGMJ-UHFFFAOYSA |
| InChI=1/C7H3N3/c8-4-6-2-1-3-7(5-9)10-6/h1-3H |
| 2,6-Pyridinedicarbonitrile |
| MFCD00129021 |
| pyridine-2,6-carbodinitrile |
| 2,6-pyridine dicarbonitrile |
| EINECS 220-766-1 |