2,2-Dibromo-2-(diethoxyphosphinyl)acetic acid ethyl ester
Modify Date: 2025-08-20 18:40:15
2,2-Dibromo-2-(diethoxyphosphinyl)acetic acid ethyl ester structure
|
Common Name | 2,2-Dibromo-2-(diethoxyphosphinyl)acetic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 28845-75-2 | Molecular Weight | 381.98300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15Br2O5P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | ethyl 2,2-dibromo-2-diethoxyphosphorylacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15Br2O5P |
|---|---|
| Molecular Weight | 381.98300 |
| Exact Mass | 379.90200 |
| PSA | 71.64000 |
| LogP | 3.25920 |
| InChIKey | XKZDOIGWQFLTMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)(Br)P(=O)(OCC)OCC |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2810 6.1 / PGIII |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~90%
2,2-Dibromo-2-(... CAS#:28845-75-2 |
| Literature: McKenna, Charles E.; Khawli, Leslie A. Journal of Organic Chemistry, 1986 , vol. 51, # 26 p. 5467 - 5471 |
|
~%
2,2-Dibromo-2-(... CAS#:28845-75-2 |
| Literature: Faisca Phillips, Ana Maria; Barros, Maria Teresa European Journal of Organic Chemistry, 2014 , vol. 2014, # 1 p. 152 - 163 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| triethyl dibromophosphonoacetate |
| triethyl 2,2-dibromophosphonoacetate |
| Ethyl 2,2-dibromodiethylphosphonoacetate |
| dibromo phosphonoacetate de diethyle |