| Name |
(S)-N*1*-(2-pyridin-4-yl-5,6,7,8-tetrahydro-benzo[4,5]thieno[2,3-d]pyrimidin-4-yl)-butane-1,2-diamine
|
| Molecular Formula |
C19H23N5S
|
| Molecular Weight |
353.5
|
| Smiles |
CCC(N)CNc1nc(-c2ccncc2)nc2sc3c(c12)CCCC3
|
CCC(N)CNc1nc(-c2ccncc2)nc2sc3c(c12)CCCC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.