Boc-Ala-Gly-OH structure
|
Common Name | Boc-Ala-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 28782-78-7 | Molecular Weight | 246.26000 | |
| Density | 1.19g/cm3 | Boiling Point | 484.4ºC at 760mmHg | |
| Molecular Formula | C10H18N2O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 246.8ºC | |
Use of Boc-Ala-Gly-OH(S)-2-(2-((tert-Butoxycarbonyl)amino)propanamido)acetic acid is a Glycine (HY-Y0966) derivative[1]. |
| Name | boc-ala-gly-oh |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-(2-((tert-Butoxycarbonyl)amino)propanamido)acetic acid is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 484.4ºC at 760mmHg |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26000 |
| Flash Point | 246.8ºC |
| Exact Mass | 246.12200 |
| PSA | 104.73000 |
| LogP | 0.88220 |
| Vapour Pressure | 1.03E-10mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | PBGVVLQMNSPMKN-LURJTMIESA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NCC(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-Ala-Gly-OH |
| N-[N-[(1,1-dimethylethoxy)carbonyl]-L-alanyl]glycine |
| (S)-2-(2-((tert-Butoxycarbonyl)amino)propanamido)acetic acid |
| Glycine,N-[(1,1-diMethylethoxy)carbonyl]-L-alanyl |
| N-(tert-butyloxycarbonyl)-(S)-alanylglycine |
| 2-((2S)-2-((tert-butoxycarbonyl)amino)propanamido)acetic acid |
| (S)-2-(2-(tert-butoxycarbonylamino)propanamido)acetic acid |
| L-BocAlaGlyOH |
| N-tert-butyloxycarbonyl-L-alanyl-glycine |