Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)-N15 structure
|
Common Name | Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)-N15 | ||
|---|---|---|---|---|
| CAS Number | 287476-16-8 | Molecular Weight | 267.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H28BrN | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)-N15Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)-15N is the deuterium labeled Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)[1]. |
| Name | tetrapropylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Description | Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)-15N is the deuterium labeled Tetrapropylammonium bromide(Reagent for Ion-Pair Chromatography,99%)[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C12H28BrN |
|---|---|
| Molecular Weight | 267.25500 |
| Exact Mass | 266.13800 |
| LogP | 0.44720 |
| InChIKey | BGQMOFGZRJUORO-IDBRGDLFSA-M |
| SMILES | CCC[N+](CCC)(CCC)CCC.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| Tetrapropylammonium-15N bromide |