Tetra-n-propyl-ammonium-d28 bromide structure
|
Common Name | Tetra-n-propyl-ammonium-d28 bromide | ||
|---|---|---|---|---|
| CAS Number | 284474-84-6 | Molecular Weight | 294.43400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12BrD28N | Melting Point | 270ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Tetra-n-propyl-ammonium-d28 bromideTetra-n-propyl-ammonium-d28 (bromide) is the deuterium labeled Tetra-n-propyl-ammonium bromide[1]. |
| Name | tetrakis(1,1,2,2,3,3,3-heptadeuteriopropyl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Description | Tetra-n-propyl-ammonium-d28 (bromide) is the deuterium labeled Tetra-n-propyl-ammonium bromide[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Melting Point | 270ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C12BrD28N |
| Molecular Weight | 294.43400 |
| Exact Mass | 293.31600 |
| LogP | 0.44720 |
| InChIKey | BGQMOFGZRJUORO-PJUGJBFXSA-M |
| SMILES | CCC[N+](CCC)(CCC)CCC.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| Tetrapropyl-d28 ammonium bromide |
| MFCD01074131 |