2-(1,1,2,2-tetrafluoroethoxy)nitrobenzene structure
|
Common Name | 2-(1,1,2,2-tetrafluoroethoxy)nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 28202-31-5 | Molecular Weight | 239.12400 | |
| Density | 1,471 g/cm3 | Boiling Point | 66-68°C 1mm | |
| Molecular Formula | C8H5F4NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >110°C | |
| Name | 1-nitro-2-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1,471 g/cm3 |
|---|---|
| Boiling Point | 66-68°C 1mm |
| Molecular Formula | C8H5F4NO3 |
| Molecular Weight | 239.12400 |
| Flash Point | >110°C |
| Exact Mass | 239.02100 |
| PSA | 55.05000 |
| LogP | 3.35470 |
| Vapour Pressure | 0.00979mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | NZPNQVWBJNSDMV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OC(F)(F)C(F)F |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Tetrafluoroethoxynitrobenzene |
| EINECS 248-898-5 |
| PC6774 |
| MFCD00042445 |