2-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID structure
|
Common Name | 2-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 10008-97-6 | Molecular Weight | 238.13600 | |
| Density | 1.446g/cm3 | Boiling Point | 276.6ºC at 760mmHg | |
| Molecular Formula | C9H6F4O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 121.1ºC | |
| Name | 2-(Pentafluoroethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 276.6ºC at 760mmHg |
| Molecular Formula | C9H6F4O3 |
| Molecular Weight | 238.13600 |
| Flash Point | 121.1ºC |
| Exact Mass | 238.02500 |
| PSA | 46.53000 |
| LogP | 2.62150 |
| Vapour Pressure | 0.02mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | SKLLNTQHBPZMDI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1OC(F)(F)C(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(1,1,2,2-tetrafluoroethoxy)benzoic acid |