Erysotrine structure
|
Common Name | Erysotrine | ||
|---|---|---|---|---|
| CAS Number | 27740-43-8 | Molecular Weight | 313.391 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 473.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.2±25.9 °C | |
Use of ErysotrineErysotrine, isolated from seed pods of Erythrina latissima, shows antibacterial activities[1]. |
| Name | Erysotrine |
|---|---|
| Synonym | More Synonyms |
| Description | Erysotrine, isolated from seed pods of Erythrina latissima, shows antibacterial activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.8±45.0 °C at 760 mmHg |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.391 |
| Flash Point | 141.2±25.9 °C |
| Exact Mass | 313.167786 |
| PSA | 30.93000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | WXVSPYOOFCCEII-KXBFYZLASA-N |
| SMILES | COc1cc2c(cc1OC)C13CC(OC)C=CC1=CCN3CC2 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (3β)-3,15,16-Trimethoxy-1,2,6,7-tetradehydroerythrinan |
| Erythrinan, 1,2,6,7-tetradehydro-3,15,16-trimethoxy-, (3β)- |