TH-Z835 structure
|
Common Name | TH-Z835 | ||
|---|---|---|---|---|
| CAS Number | 2766209-50-9 | Molecular Weight | 498.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H38N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TH-Z835TH-Z835 is a mutant selective KRAS (G12D) inhibitor with an IC50 of 1.6 μM. TH-Z835 inhibits both mantGMPPNP/GPPNP exchange and GPPNP/mantGMPPNP exchange[1]. |
| Name | TH-Z835 |
|---|
| Description | TH-Z835 is a mutant selective KRAS (G12D) inhibitor with an IC50 of 1.6 μM. TH-Z835 inhibits both mantGMPPNP/GPPNP exchange and GPPNP/mantGMPPNP exchange[1]. |
|---|---|
| Related Catalog | |
| Target |
KRAS(G12D):1.6 μM (IC50) |
| References |
| Molecular Formula | C30H38N6O |
|---|---|
| Molecular Weight | 498.66 |
| InChIKey | KIWVGCSJQTTZJO-VHYCJAOWSA-N |
| SMILES | Cc1cccc2cccc(N3CCc4c(nc(OCC5CCCN5C)nc4N4CC5CCC(C4)N5)C3)c12 |