3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 27619-97-2 | Molecular Weight | 428.168 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 221.2ºC at 760 mmHg | |
| Molecular Formula | C8H5F13O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.6ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 221.2ºC at 760 mmHg |
| Molecular Formula | C8H5F13O3S |
| Molecular Weight | 428.168 |
| Flash Point | 87.6ºC |
| Exact Mass | 427.975189 |
| PSA | 62.75000 |
| LogP | 3.47 |
| Vapour Pressure | 0.109mmHg at 25°C |
| Index of Refraction | 1.330 |
| InChIKey | VIONGDJUYAYOPU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C,Xi |
|---|---|
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 |
| HS Code | 2904909090 |
|
~%
3,3,4,4,5,5,6,6... CAS#:27619-97-2 |
| Literature: Rondestvedt,C.S.; Thayer,G.L. Journal of Organic Chemistry, 1977 , vol. 42, p. 2680 - 2683 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Octanesulfonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonic acid |
| 1H,1H,2H,2H-perfluorooctyl-1-sulfonic acid |
| EINECS 248-580-6 |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulfonic acid |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanesulfonic acid |
| 6:2 fluorotelomer sulfonic acid |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
| 1H,1H,2H,2H-perfluorooctane sulfonate |