3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonyl chloride structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 27619-89-2 | Molecular Weight | 446.61300 | |
| Density | 1.69g/cm3 | Boiling Point | 237.8ºC at 760mmHg | |
| Molecular Formula | C8H4ClF13O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.6ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 237.8ºC at 760mmHg |
| Molecular Formula | C8H4ClF13O2S |
| Molecular Weight | 446.61300 |
| Flash Point | 97.6ºC |
| Exact Mass | 445.94100 |
| PSA | 42.52000 |
| LogP | 5.76470 |
| Vapour Pressure | 0.0678mmHg at 25°C |
| Index of Refraction | 1.333 |
| InChIKey | NDBZVZPOTNLWLU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2904909090 |
|---|
|
~96%
3,3,4,4,5,5,6,6... CAS#:27619-89-2 |
| Literature: Taylor, Charles Kenneth; Michalczyk, Michael Joseph; Acosta, Erick Jose Patent: US2009/42996 A1, 2009 ; Location in patent: Page/Page column 6-7 ; |
|
~%
3,3,4,4,5,5,6,6... CAS#:27619-89-2 |
| Literature: BAYER SCHERING PHARMA AKTIENGESELLSCHAFT; SRINIVASAN, Ananth; BERNDT, Mathias; GRAHAM, Keith; FRIEBE, Matthias; SCHMITT-WILLICH, Heribert Patent: WO2010/409 A2, 2010 ; Location in patent: Page/Page column 21-22 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1H,1H,2H,2H-perfluoroctyl-1-sulfonic acid chloride |
| EINECS 248-576-4 |
| 1H,1H,2H,2H-perfluorooctyl sulfonyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-n-octanesulfonyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonyl chloride |
| perfluorohexyl ethyl sulfonyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANESULFONYL CHLORIDE |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanyl-1-sulfonylchloride |
| 2-(perfluorohexyl)ethanesulfonyl chloride |