Butyl diphenyl phosphate structure
|
Common Name | Butyl diphenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 2752-95-6 | Molecular Weight | 306.293 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 368.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H19O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2±40.7 °C | |
| Name | Butyl diphenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.4±15.0 °C at 760 mmHg |
| Molecular Formula | C16H19O4P |
| Molecular Weight | 306.293 |
| Flash Point | 190.2±40.7 °C |
| Exact Mass | 306.102081 |
| PSA | 54.57000 |
| LogP | 4.69 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | DIBUFQMCUZYQKN-UHFFFAOYSA-N |
| SMILES | CCCCOP(=O)(Oc1ccccc1)Oc1ccccc1 |
| HS Code | 2919900090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphorsaeure-butylester-diphenylester |
| Phosphorsaeure-butyl-diphenylester |
| (n-Butyl)-diphenylphosphat |
| Butyl diphenyl phosphate |
| Phosphoric acid, butyl diphenyl ester |
| EINECS 220-398-1 |
| Diphenylphosphorsaeure-n-butylester |
| Phosphoric acid,butyl diphenyl ester |
| phosphoric acid butyl ester-diphenyl ester |