Diphenyl chlorophosphate structure
|
Common Name | Diphenyl chlorophosphate | ||
|---|---|---|---|---|
| CAS Number | 2524-64-3 | Molecular Weight | 268.633 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 363.5±11.0 °C at 760 mmHg | |
| Molecular Formula | C12H10ClO3P | Melting Point | 314-316ºC | |
| MSDS | Chinese USA | Flash Point | 256.2±26.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | [chloro(phenoxy)phosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.5±11.0 °C at 760 mmHg |
| Melting Point | 314-316ºC |
| Molecular Formula | C12H10ClO3P |
| Molecular Weight | 268.633 |
| Flash Point | 256.2±26.9 °C |
| Exact Mass | 268.005615 |
| PSA | 45.34000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | BHIIGRBMZRSDRI-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(Oc1ccccc1)Oc1ccccc1 |
| Water Solubility | MAY DECOMPOSE |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S7-S24/25-S23 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 29209085 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 29209085 |
|---|
|
Mechanism of formation of reovirus mRNA 5'-terminal blocked and methylated sequence, m7GpppGmpC.
J. Biol. Chem. 251(16) , 5043-53, (1976) Blocked and methylated 5' termini of reovirus mRNA are formed by viral cores at an early stage of transcription. Cores incubated in a complete transcription reaction mixture for 30 s, or in a mixture ... |
|
|
Tetrahedron Lett. 34 , 2461, (1993)
|
|
|
Carbohydr. Res. 223 , 169, (1992)
|
| EINECS 219-759-6 |
| diphenyl chloridophosphate |
| Diphenyl chlorophosphate |
| diphenylchlorophosphate |
| Chlorodiphenoxyphosphine oxide |
| Phosphorochloridic Acid Diphenyl Ester |
| Chlorodiphenyl Phosphate |
| diphenoxyphosphinyl chloride |
| MFCD00003030 |
| Diphenyl phosphorochloridate |
| Phosphorochloridic acid, diphenyl ester |
| Diphenylphosphoric acid monochloride |
| Diphenyl chlorophosphate,Diphenyl phosphorochloridate |
| Diphenyl phosphoryl chloride |
| Diphenylphosphoryl chloride |
| Diphenyl phosphochloridate |
| O,O-Diphenyl chlorophosphate |
| ROPO&GOR |
| Diphenoxychlorophosphine oxide |
| diphenoxyphosphoryl chloride |