benzene,tert-butyl diphenyl phosphate,triphenyl phosphate
Modify Date: 2025-09-21 23:15:03
benzene,tert-butyl diphenyl phosphate,triphenyl phosphate structure
|
Common Name | benzene,tert-butyl diphenyl phosphate,triphenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 96300-96-8 | Molecular Weight | 710.68800 | |
| Density | N/A | Boiling Point | 412.4ºC at 760 mmHg | |
| Molecular Formula | C40H40O8P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | benzene,tert-butyl diphenyl phosphate,triphenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 412.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C40H40O8P2 |
| Molecular Weight | 710.68800 |
| Flash Point | 201.2ºC |
| Exact Mass | 710.22000 |
| PSA | 109.14000 |
| LogP | 12.08570 |
| InChIKey | UJYTVCBASRGXMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(Oc1ccccc1)Oc1ccccc1.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.c1ccccc1 |
| tert-Butylphenyl diphenyl phosphate mixt. with triphenyl phosphate |
| Phosphoric acid,triphenyl ester,mixt. with (1,1-dimethylethyl)phenyl diphenyl phosphate |
| Phosphoric acid,(1,1-dimethylethyl)phenyl diphenyl ester,mixt. with triphenyl phosphate |
| Phosphoric acid,4-(1,1-dimethylethyl)phenyl diphenyl ester,mixt. with triphenyl phosphate |