Benzeneethaneperoxoicacid, 4-methoxy-, 1,1-dimethylethyl ester structure
|
Common Name | Benzeneethaneperoxoicacid, 4-methoxy-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 27396-21-0 | Molecular Weight | 238.28000 | |
| Density | 1.072g/cm3 | Boiling Point | 314.1ºC at 760mmHg | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.4ºC | |
| Name | tert-butyl 2-(4-methoxyphenyl)ethaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 314.1ºC at 760mmHg |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28000 |
| Flash Point | 134.4ºC |
| Exact Mass | 238.12100 |
| PSA | 44.76000 |
| LogP | 2.51100 |
| Vapour Pressure | 0.000477mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | YDMQBAPTQDAGCV-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)OOC(C)(C)C)cc1 |
|
~%
Benzeneethanepe... CAS#:27396-21-0 |
| Literature: Ruechardt,C.; Grundmeier,M. Chemische Berichte, 1975 , vol. 108, p. 2448 - 2464 |
|
~%
Benzeneethanepe... CAS#:27396-21-0 |
| Literature: Kim, Sung Soo; Tuchkin, Alexey Journal of Organic Chemistry, 1999 , vol. 64, # 11 p. 3821 - 3824 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| Benzeneethaneperoxoicacid,4-methoxy-,1,1-dimethylethyl ester |
| t-Butyl-p-methoxyphenylperacetat |
| tert-Butylp-methoxyphenylperacetate |
| p-Methoxyphenylperessigsaeure-tert.-butylester |
| tert.-Butyl-p-methoxyphenylperacetat |