RIPK1-IN-9
Modify Date: 2025-11-30 16:47:25
RIPK1-IN-9 structure
|
Common Name | RIPK1-IN-9 | ||
|---|---|---|---|---|
| CAS Number | 2682889-57-0 | Molecular Weight | 472.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H25FN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RIPK1-IN-9RIPK1-IN-9 (example 45), a dihydronaphthyridone compound, is a potent and selective RIPK1 inhibitor. RIPK1-IN-9 inhibits U937 cell (IC50=2 nM) and L929 cell (IC50=1.3 nM)[1]. |
| Name | RIPK1-IN-9 |
|---|
| Description | RIPK1-IN-9 (example 45), a dihydronaphthyridone compound, is a potent and selective RIPK1 inhibitor. RIPK1-IN-9 inhibits U937 cell (IC50=2 nM) and L929 cell (IC50=1.3 nM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H25FN6O2 |
|---|---|
| Molecular Weight | 472.51 |
| InChIKey | NFZIVWWKQSSLRB-UHFFFAOYSA-N |
| SMILES | Nc1nc2cc(-c3cnc4c(c3)C(=O)N(Cc3cc(F)ccc3OC3CCCC3)CC4)ccn2n1 |