(4-Benzoylphenyl)boronic acid structure
|
Common Name | (4-Benzoylphenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 268218-94-6 | Molecular Weight | 226.036 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 427.9±47.0 °C at 760 mmHg | |
| Molecular Formula | C13H11BO3 | Melting Point | 204-212ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 212.6±29.3 °C | |
| Name | (4-benzoylphenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.9±47.0 °C at 760 mmHg |
| Melting Point | 204-212ºC(lit.) |
| Molecular Formula | C13H11BO3 |
| Molecular Weight | 226.036 |
| Flash Point | 212.6±29.3 °C |
| Exact Mass | 226.080124 |
| PSA | 57.53000 |
| LogP | 2.55 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | CWMIVCCXDVRXST-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(B(O)O)cc1 |
| Storage condition | 2~8 ℃ |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C: Corrosive; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (4-Benzoylphenyl)boronic acid |
| 4-Benzoylphenylboronic acid |
| MFCD05664212 |
| Boronic acid, B-(4-benzoylphenyl)- |
| 4-Benzoylbenzeneboronic Acid |
| 4-(Phenylcarbonyl)phenylboronic acid |