Mal-PEG8-Phe-Lys-PAB-Exatecan
Modify Date: 2024-03-15 12:12:33
Mal-PEG8-Phe-Lys-PAB-Exatecan structure
|
Common Name | Mal-PEG8-Phe-Lys-PAB-Exatecan | ||
|---|---|---|---|---|
| CAS Number | 2679821-44-2 | Molecular Weight | 1434.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C73H92FN9O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-PEG8-Phe-Lys-PAB-ExatecanMal-PEG8-Phe-Lys-PAB-Exatecan (compound 15) is a drug-linker conjugate for ADC, composed of degradable linker Mal-PEG8-Phe-Lys-PAB and toxin molecule Exatecan (HY-13631) composition[1]. |
| Name | Mal-PEG8-Phe-Lys-PAB-Exatecan |
|---|
| Description | Mal-PEG8-Phe-Lys-PAB-Exatecan (compound 15) is a drug-linker conjugate for ADC, composed of degradable linker Mal-PEG8-Phe-Lys-PAB and toxin molecule Exatecan (HY-13631) composition[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Manel KRAIEM. Treatment of cancer. Patent WO2021151984A1. |
| Molecular Formula | C73H92FN9O20 |
|---|---|
| Molecular Weight | 1434.56 |
| InChIKey | QTWLWMWXCBYFMN-IOAOLUGKSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(NC(=O)OCc1ccc(NC(=O)C(CCCCN)NC(=O)C(Cc2ccccc2)NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN2C(=O)C=CC2=O)cc1)CC3 |