Mal-PEG8-acid
Modify Date: 2025-08-25 07:46:57
Mal-PEG8-acid structure
|
Common Name | Mal-PEG8-acid | ||
|---|---|---|---|---|
| CAS Number | 1818294-46-0 | Molecular Weight | 521.555 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 634.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H39NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.6±31.5 °C | |
Use of Mal-PEG8-acidMal-PEG8-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | Mal-PEG8-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-PEG8-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 634.6±55.0 °C at 760 mmHg |
| Molecular Formula | C23H39NO12 |
| Molecular Weight | 521.555 |
| Flash Point | 337.6±31.5 °C |
| Exact Mass | 521.247253 |
| LogP | -2.88 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | KLZPPWOSICDUKQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| MFCD26793771 |
| 1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid |
| 3,6,9,12,15,18,21,24-Octaoxaheptacosan-27-oic acid, 1-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)- |