DMT-2'-F-dA(bz) phosphoramidite structure
|
Common Name | DMT-2'-F-dA(bz) phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 2659239-37-7 | Molecular Weight | 889.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H53FN7O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DMT-2'-F-dA(bz) phosphoramiditeDMT-2'-F-dA(bz) phosphoramidite is a phosphoramidite that can be used in the synthesis of oligonucleotides. |
| Name | DMT-2'-F-dA(bz) phosphoramidite |
|---|
| Description | DMT-2'-F-dA(bz) phosphoramidite is a phosphoramidite that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Molecular Formula | C48H53FN7O7P |
|---|---|
| Molecular Weight | 889.95 |
| InChIKey | UTNWUIGRRCGISW-ZDAUAZEPSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(N(C)C(=O)c5ccccc5)ncnc43)C(F)C2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |