Z-Gln-OH structure
|
Common Name | Z-Gln-OH | ||
|---|---|---|---|---|
| CAS Number | 2650-64-8 | Molecular Weight | 280.276 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 604.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O5 | Melting Point | 134-138 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 319.2±31.5 °C | |
Use of Z-Gln-OHZ-Gln-OH is a glutamine derivative[1]. |
| Name | (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Gln-OH is a glutamine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 604.2±55.0 °C at 760 mmHg |
| Melting Point | 134-138 °C(lit.) |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.276 |
| Flash Point | 319.2±31.5 °C |
| Exact Mass | 280.105927 |
| PSA | 118.72000 |
| LogP | 0.72 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | JIMLDJNLXLMGLX-JTQLQIEISA-N |
| SMILES | NC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cbz-L-Gln-OH |
| N-Carbobenzoxy-L-glutamine |
| cbz-L-glutamine |
| L-Glutamine, N2-[(phenylmethoxy)carbonyl]- |
| N-Benzyloxycarbonyl-L-glutamine |
| N-Cbz-L-glutamine |
| (2S)-5-Amino-2-{[(benzyloxy)carbonyl]amino}-5-oxopentanoic acid |
| Carbobenzyloxy-L-glutamine |
| EINECS 220-173-8 |
| L-Glutamine, N-[(phenylmethoxy)carbonyl]- |
| Nα-Benzyloxycarbonyl-L-glutamine |
| (S)-5-Amino-2-(((benzyloxy)carbonyl)amino)-5-oxopentanoic acid |
| N-carbobenzyloxy-L-glutamine |
| N-[(Benzyloxy)carbonyl]-L-glutamine |
| N2-Carbobenzoxy-L-glutamine |
| MFCD00008043 |
| N-Cbz-glutamine |
| Z-L-Glutamine |
| N-(Benzyloxycarbonyl)-L-glutamine |
| Z-Gln-OH |
| Benzyloxycarbonyl-L-glutamine |