cyanophos structure
|
Common Name | cyanophos | ||
|---|---|---|---|---|
| CAS Number | 2636-26-2 | Molecular Weight | 243.219 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 322.3±44.0 °C at 760 mmHg | |
| Molecular Formula | C9H10NO3PS | Melting Point | 14-15ºC | |
| MSDS | Chinese USA | Flash Point | 148.7±28.4 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | cyanophos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.3±44.0 °C at 760 mmHg |
| Melting Point | 14-15ºC |
| Molecular Formula | C9H10NO3PS |
| Molecular Weight | 243.219 |
| Flash Point | 148.7±28.4 °C |
| Exact Mass | 243.011902 |
| PSA | 93.38000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | SCKHCCSZFPSHGR-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc(C#N)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312-H410 |
| Precautionary Statements | P273-P280-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R21/22 |
| Safety Phrases | 36/37-60-61 |
| RIDADR | 3018 |
| RTECS | TF7600000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2926909032 |
| HS Code | 2926909032 |
|---|---|
| Summary | 2926909032 o-(4-cyanophenyl) o,o-dimethyl phosphorothioate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Development of phage immuno-loop-mediated isothermal amplification assays for organophosphorus pesticides in agro-products.
Anal. Chem. 86(16) , 8441-7, (2014) Two immuno-loop-mediated isothermal amplification assays (iLAMP) were developed by using a phage-borne peptide that was isolated from a cyclic eight-peptide phage library. One assay was used to screen... |
|
|
[Health standardization of Cyanox in water].
Gig. Sanit. (9) , 76-7, (1983)
|
|
|
[Contamination of sugar cane by 2 bird poisons: fenthion and cyanophos. Evaluation of residues in sugar cane juice transformed into sugar].
Dakar Med. 29(2) , 383-90, (1984)
|
| Caswell No. 268A |
| Sumitomo S 4084 |
| Phosphorothioic Acid O,O-Dimethyl Ester O-Ester with p-Hydroxybenzonitrile |
| Sunitomo S 4084 |
| Ciafos |
| Cyanox |
| 4-dimethoxyphosphinothioyloxybenzonitrile |
| Phosphorothioic Acid O-(4-Cyanophenyl) O,O-Dimethyl Ester |
| Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
| O-(4-Cyanphenyl)-O,O-dimethylthiophosphat |
| Thiophosphate de O-(4-cyanophényle) et de O,O-diméthyle |
| Cynock |
| cyanophos |
| O-4-cyanophenyl O,O-dimethyl phosphorothioate |
| O,O-dimethyl O-4-cyanophenyl phosphorothioate |
| May & baker S 4084 |
| EINECS 220-130-3 |
| O,O-dimethyl-o-p-cyanophenyl phosphorothioate |
| O-(4-Cyanophenyl) O,O-dimethyl phosphorothioate |
| MFCD00055485 |
| O,O-Dimethyl O-(4-Cyanophenyl) Phosphorothioate |
| CYAP |
| O-p-cyanophenyl O,O-dimethyl phosphorothioate |