4-dimethoxyphosphinothioyloxy-3-methyl-benzonitrile
Modify Date: 2025-10-09 15:58:11
4-dimethoxyphosphinothioyloxy-3-methyl-benzonitrile structure
|
Common Name | 4-dimethoxyphosphinothioyloxy-3-methyl-benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 76211-54-6 | Molecular Weight | 257.24600 | |
| Density | 1.27g/cm3 | Boiling Point | 346.3ºC at 760 mmHg | |
| Molecular Formula | C10H12NO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | 4-dimethoxyphosphinothioyloxy-3-methylbenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 346.3ºC at 760 mmHg |
| Molecular Formula | C10H12NO3PS |
| Molecular Weight | 257.24600 |
| Flash Point | 163.2ºC |
| Exact Mass | 257.02800 |
| PSA | 93.38000 |
| LogP | 3.41338 |
| Index of Refraction | 1.549 |
| InChIKey | VJEQJCFWMZOKRZ-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc(C#N)cc1C |
| HS Code | 2926909090 |
|---|
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| O-4-Cyano-o-tolyl O,O-dimethyl phosphorothioate |
| O,O-Dimethyl-O-<2-methyl-4-cyan-phenyl>-thiophosphorsaeure |
| Phosphorothioic acid,O,O-dimethyl ester,O-ester with 4,3-cresotonitrile |
| Methyl 3-cyanophos |