Benzamide,N-(4-bromophenyl)-2-hydroxy-
Modify Date: 2025-09-18 20:04:20
Benzamide,N-(4-bromophenyl)-2-hydroxy- structure
|
Common Name | Benzamide,N-(4-bromophenyl)-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 2627-77-2 | Molecular Weight | 292.12800 | |
| Density | 1.597g/cm3 | Boiling Point | 338.3ºC at 760mmHg | |
| Molecular Formula | C13H10BrNO2 | Melting Point | 172ºC | |
| MSDS | N/A | Flash Point | 158.4ºC | |
| Name | N-(4-bromophenyl)-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.597g/cm3 |
|---|---|
| Boiling Point | 338.3ºC at 760mmHg |
| Melting Point | 172ºC |
| Molecular Formula | C13H10BrNO2 |
| Molecular Weight | 292.12800 |
| Flash Point | 158.4ºC |
| Exact Mass | 290.98900 |
| PSA | 49.33000 |
| LogP | 3.48000 |
| Vapour Pressure | 5.06E-05mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | DKQMTUHJJPFJRL-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccccc1O |
| HS Code | 2924299090 |
|---|
|
~78%
Benzamide,N-(4-... CAS#:2627-77-2 |
| Literature: Lu, Cheng-Rong; Zhao, Bei; Jiang, Ying-Peng; Ding, Hao; Yang, Sheng Synthetic Communications, 2011 , vol. 41, # 9 p. 1257 - 1266 |
|
~%
Benzamide,N-(4-... CAS#:2627-77-2 |
| Literature: Coburn; Batista; Evans; Genco Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1245 - 1249 |
|
~%
Benzamide,N-(4-... CAS#:2627-77-2 |
| Literature: Coburn; Batista; Evans; Genco Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1245 - 1249 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Salicyloyl-4-brom-anilin |
| Salicylsaeure-<4-brom-anilid> |
| Salicylsaeure-p-bromanilid |
| 4'-Bromo-2-hydroxybenzanilide |
| 4'-Bromosalicylanilide |
| 4'-BROMOSALICYLANILIDE |
| 2-Oxybenz-4-bromanilid |