1-hydroxy-6-nitrobenzotriazole structure
|
Common Name | 1-hydroxy-6-nitrobenzotriazole | ||
|---|---|---|---|---|
| CAS Number | 26185-63-7 | Molecular Weight | 180.12100 | |
| Density | 1.89g/cm3 | Boiling Point | 458.8ºC at 760 mmHg | |
| Molecular Formula | C6H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.3ºC | |
| Name | 1-hydroxy-6-nitrobenzotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 458.8ºC at 760 mmHg |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12100 |
| Flash Point | 231.3ºC |
| Exact Mass | 180.02800 |
| PSA | 96.76000 |
| LogP | 1.10000 |
| Vapour Pressure | 4.87E-09mmHg at 25°C |
| Index of Refraction | 1.828 |
| InChIKey | HZPVTKPGROKWRL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2nnn(O)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-nitro-1-hydroxy-1,2,3-benzotriazole |
| OHNBT |
| 6-nitro-1H-benzotriazol-1-ol |
| 1-hydroxy-6-nitro-1,2,3-benzotriazole |
| 6-nitro-1-hydroxybenzotriazole |
| 6-Nitro-benzotriazol-1-ol |