D-Phenothrin structure
|
Common Name | D-Phenothrin | ||
|---|---|---|---|---|
| CAS Number | 26046-85-5 | Molecular Weight | 350.45100 | |
| Density | 1.12 g/cm3 | Boiling Point | 437ºC at 760 mmHg | |
| Molecular Formula | C23H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.6ºC | |
Use of D-PhenothrinD-Phenothrin ((-)-trans-Phenothrin), an orally active Type II synthetic pyrethroid, is widely used to kill insects, mosquitoes, and human lice. D-Phenothrin is also used in veterinary medicine to control insect pests on animals and protect agricultural crops[1]. |
| Name | (3-phenoxyphenyl)methyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | D-Phenothrin ((-)-trans-Phenothrin), an orally active Type II synthetic pyrethroid, is widely used to kill insects, mosquitoes, and human lice. D-Phenothrin is also used in veterinary medicine to control insect pests on animals and protect agricultural crops[1]. |
|---|---|
| Related Catalog | |
| In Vivo | D-Phenothrin ((-)-trans-Phenothrin; 25-200 mg/kg; IP; 14 consecutive days) significantly, dose-dependently increases oxidative DNA damage in both organs of animals[1]. D-Phenothrin (100, 300 or 1000 mg/kg/day; p.o.; 3 days) exhibits no potential to cause adverse estrogenic or (anti-)androgenic effects[2]. Animal Model: Male Wistar albino rats (6-week-old, 150-200 g) Dosage: 25, 50, 100, 200 mg/kg Administration: IP; 14 consecutive days Result: Had a statistically significant, dose-dependent increase in oxidative DNA damage in both organs of animals. |
| References |
| Density | 1.12 g/cm3 |
|---|---|
| Boiling Point | 437ºC at 760 mmHg |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.45100 |
| Flash Point | 186.6ºC |
| Exact Mass | 350.18800 |
| PSA | 35.53000 |
| LogP | 5.76050 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | SBNFWQZLDJGRLK-RTWAWAEBSA-N |
| SMILES | CC(C)=CC1C(C(=O)OCc2cccc(Oc3ccccc3)c2)C1(C)C |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S24/25-S37/39-S26 |
|
~%
D-Phenothrin CAS#:26046-85-5 |
| Literature: Magnetic Resonance in Chemistry, , vol. 31, # 1 p. 90 - 93 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| biophenothrin |
| trans-4-Hydroxy-1-hydroxymethyl-cyclohexan |
| EINECS 247-431-2 |
| 1-Chlor-trans,trans-dimethylcyclopropan |
| 1r-Chlor-2t,3t-dimethyl-cyclopropan |
| 1-Chlor-2,3-cis-dimethylcyclopropan |
| trans-4-Hydroxycyclohexylcarbinol |
| trans-4-Hydroxymethyl-cyclohexanol |
| 1R-trans-Phenothrin |
| MFCD01735786 |
| 1r-chloro-2t,3t-dimethyl-cyclopropane |
| D-Phenothrin |