PF-1163B structure
|
Common Name | PF-1163B | ||
|---|---|---|---|---|
| CAS Number | 258871-60-2 | Molecular Weight | 461.634 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 649.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H43NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.8±30.1 °C | |
Use of PF-1163BPF-1163B is an antifungal antibiotic[1]. |
| Name | PF-1163B |
|---|---|
| Synonym | More Synonyms |
| Description | PF-1163B is an antifungal antibiotic[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 649.9±50.0 °C at 760 mmHg |
| Molecular Formula | C27H43NO5 |
| Molecular Weight | 461.634 |
| Flash Point | 346.8±30.1 °C |
| Exact Mass | 461.314117 |
| LogP | 5.44 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | PCRJJAXIHTZHNU-SDUSCBPUSA-N |
| SMILES | CCCCCC1CCC(C)CCCCC(=O)N(C)C(Cc2ccc(OCCO)cc2)C(=O)O1 |
| 1-Oxa-4-azacyclotridecane-2,5-dione, 3-[[4-(2-hydroxyethoxy)phenyl]methyl]-4,10-dimethyl-13-pentyl-, (3S,10R,13R)- |
| (3S,10R,13R)-3-[4-(2-Hydroxyethoxy)benzyl]-4,10-dimethyl-13-pentyl-1-oxa-4-azacyclotridecane-2,5-dione |
| PF-1163B |
| PF 1163B |