H-Phe-Phe-Phe-OH structure
|
Common Name | H-Phe-Phe-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 2578-81-6 | Molecular Weight | 459.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Phe-Phe-Phe-OHH-Phe-Phe-Phe-OH is an aromatic tripeptide that has the potential to be used as DNA molecular probe[1]. |
| Name | Phe-Phe-Phe |
|---|---|
| Synonym | More Synonyms |
| Description | H-Phe-Phe-Phe-OH is an aromatic tripeptide that has the potential to be used as DNA molecular probe[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H29N3O4 |
|---|---|
| Molecular Weight | 459.54 |
| Exact Mass | 459.21600 |
| PSA | 121.52000 |
| LogP | 3.57810 |
| Vapour Pressure | 3.18E-26mmHg at 25°C |
| InChIKey | CBENHWCORLVGEQ-HJOGWXRNSA-N |
| SMILES | NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| h-phe-phe-phe-oh |