n-benzoyl-l-tyrosine structure
|
Common Name | n-benzoyl-l-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 2566-23-6 | Molecular Weight | 285.29500 | |
| Density | 1.315g/cm3 | Boiling Point | 598.2ºC at 760mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | 163.0 to 167.0 °C | |
| MSDS | N/A | Flash Point | 315.6ºC | |
Use of n-benzoyl-l-tyrosineN-Benzoyl-L-tyrosine is a tyrosine derivative[1]. |
| Name | (2S)-2-benzamido-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Benzoyl-L-tyrosine is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 598.2ºC at 760mmHg |
| Melting Point | 163.0 to 167.0 °C |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 315.6ºC |
| Exact Mass | 285.10000 |
| PSA | 86.63000 |
| LogP | 2.20880 |
| Vapour Pressure | 3.72E-15mmHg at 25°C |
| Index of Refraction | -77.5 ° (C=1, DMF) |
| InChIKey | KUUUDPTUEOKITK-AWEZNQCLSA-N |
| SMILES | O=C(NC(Cc1ccc(O)cc1)C(=O)O)c1ccccc1 |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Benzoyltyrosine |
| (S)-2-Benzamido-3-(4-hydroxyphenyl)propanoic acid |
| N-Benzoyl-L-tyrosin |
| L-Tyrosine,N-benzoyl |
| N-Benzoyl-L-tyrosine |
| benzoyltyrosine |
| N-benzoyl-L-tyrosine |
| N-Benzoyl-DL-tyrosine |