Thalidomide-4-O-C10-COOH structure
|
Common Name | Thalidomide-4-O-C10-COOH | ||
|---|---|---|---|---|
| CAS Number | 2379870-45-6 | Molecular Weight | 458.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-4-O-C10-COOHThalidomide-4-O-C10-COOH is a E3 ligase ligand-linker conjugate that can be used in the synthesis of PROTACs. |
| Name | Thalidomide-4-O-C10-COOH |
|---|
| Description | Thalidomide-4-O-C10-COOH is a E3 ligase ligand-linker conjugate that can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H30N2O7 |
|---|---|
| Molecular Weight | 458.50 |
| InChIKey | VABSDQARWOAAFM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|