2,3-Dichloro-6-nitroquinoxaline structure
|
Common Name | 2,3-Dichloro-6-nitroquinoxaline | ||
|---|---|---|---|---|
| CAS Number | 2379-60-4 | Molecular Weight | 244.034 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 362.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H3Cl2N3O2 | Melting Point | 151-155ºC(lit.) | |
| MSDS | N/A | Flash Point | 172.7±26.5 °C | |
| Name | 2,3-dichloro-6-nitroquinoxaline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.0±37.0 °C at 760 mmHg |
| Melting Point | 151-155ºC(lit.) |
| Molecular Formula | C8H3Cl2N3O2 |
| Molecular Weight | 244.034 |
| Flash Point | 172.7±26.5 °C |
| Exact Mass | 242.960236 |
| PSA | 71.60000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | SFJCUOAQTGDBPO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2nc(Cl)c(Cl)nc2c1 |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R25;R37/38;R41 |
| Safety Phrases | 22-26-36/37/39-45 |
| RIDADR | UN 2811 |
| HS Code | 2933990090 |
|
~90%
2,3-Dichloro-6-... CAS#:2379-60-4 |
| Literature: Deng, Jing; Feng, Enguang; Ma, Sheng; Zhang, Yan; Liu, Xiaofeng; Li, Honglin; Huang, Huang; Zhu, Jin; Zhu, Weiliang; Shen, Xu; Miao, Liyan; Liu, Hong; Jiang, Hualiang; Li, Jian Journal of Medicinal Chemistry, 2011 , vol. 54, # 13 p. 4508 - 4522 |
|
~%
2,3-Dichloro-6-... CAS#:2379-60-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 8 p. 2118 - 2122 |
|
~%
2,3-Dichloro-6-... CAS#:2379-60-4 |
| Literature: Yakugaku Zasshi, , vol. 79, p. 260,262 Chem.Abstr., , p. 13160 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Dichloro-6-nitroquinoxaline |
| Quinoxaline, 2,3-dichloro-6-nitro- |
| 2 3-Dichloro-6-nitroquinoxaline |
| 2,3-dichloro-7-nitroquinoxaline |
| MFCD00454905 |
| 6-nitro 2,3-dichloroquinoxaline |
| 2,3-Dichlor-6-nitro-chinoxalin |
| quinoxaline,2,3-dichloro-6-nitro |