1-[3-fluoro-4-(trifluoromethyl)phenyl]propan-1-one structure
|
Common Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 237761-78-3 | Molecular Weight | 220.16400 | |
| Density | 1.256g/cm3 | Boiling Point | 244ºC at 760mmHg | |
| Molecular Formula | C10H8F4O | Melting Point | 35-38ºC | |
| MSDS | N/A | Flash Point | 92.7ºC | |
| Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 244ºC at 760mmHg |
| Melting Point | 35-38ºC |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.16400 |
| Flash Point | 92.7ºC |
| Exact Mass | 220.05100 |
| PSA | 17.07000 |
| LogP | 3.43720 |
| Vapour Pressure | 0.031mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | FUSVMXQCFHNSHP-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(C(F)(F)F)c(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3′-Fluoro-4′-(trifluoromethyl)propiophenone |
| MFCD00236306 |