3'-Fluoro-5'-(trifluoromethyl)propiophenone structure
|
Common Name | 3'-Fluoro-5'-(trifluoromethyl)propiophenone | ||
|---|---|---|---|---|
| CAS Number | 207974-20-7 | Molecular Weight | 220.163 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 202.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H8F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 75.2±20.1 °C | |
| Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 202.1±35.0 °C at 760 mmHg |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.163 |
| Flash Point | 75.2±20.1 °C |
| Exact Mass | 220.051132 |
| PSA | 17.07000 |
| LogP | 3.19 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.437 |
| InChIKey | KEAIAOPGXGEINJ-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-[3-Fluoro-5-(trifluoromethyl)phenyl]propan-1-one |
| MFCD00061262 |
| FXFFR CF EV2 |
| 3′-Fluoro-5′-(trifluoromethyl)propiophenone |
| 1-Propanone, 1-[3-fluoro-5-(trifluoromethyl)phenyl]- |
| 1-[3-Fluoro-5-(trifluoromethyl)phenyl]-1-propanone |
| 3'-Fluoro-5'-(trifluoromethyl)propiophenone |