BRD-8000.3
Modify Date: 2025-08-27 05:14:13
BRD-8000.3 structure
|
Common Name | BRD-8000.3 | ||
|---|---|---|---|---|
| CAS Number | 2365504-95-4 | Molecular Weight | 401.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21BrN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BRD-8000.3BRD-8000.3, as a specific EfpA inhibitor, is a narrow-spectrum, bactericidal antimycobacterial agent with good wild-type activity. BRD-8000.3 can be used for the research of tuberculosis[1]. |
| Name | BRD-8000.3 |
|---|
| Description | BRD-8000.3, as a specific EfpA inhibitor, is a narrow-spectrum, bactericidal antimycobacterial agent with good wild-type activity. BRD-8000.3 can be used for the research of tuberculosis[1]. |
|---|---|
| Related Catalog | |
| Target |
EfpA[1] |
| In Vitro | BRD-8000.3, as a specific EfpA inhibitor, is a narrow-spectrum, bactericidal antimycobacterial agent with good wild-type activity[1]. |
| References |
| Molecular Formula | C19H21BrN4O |
|---|---|
| Molecular Weight | 401.30 |
| InChIKey | XIITZGMKUBIQRI-DZGCQCFKSA-N |
| SMILES | CC(C)=CC1C(C(=O)Nc2ccc(-c3ncccn3)c(Br)n2)C1(C)C |