methyl N-(3-trimethoxysilylpropyl)carbamate structure
|
Common Name | methyl N-(3-trimethoxysilylpropyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 23432-62-4 | Molecular Weight | 237.32600 | |
| Density | 1.109 g/cm3 | Boiling Point | 102ºC 7,5mm | |
| Molecular Formula | C8H19NO5Si | Melting Point | N/A | |
| MSDS | USA | Flash Point | 141ºC | |
| Name | methyl N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109 g/cm3 |
|---|---|
| Boiling Point | 102ºC 7,5mm |
| Molecular Formula | C8H19NO5Si |
| Molecular Weight | 237.32600 |
| Flash Point | 141ºC |
| Exact Mass | 237.10300 |
| PSA | 66.02000 |
| LogP | 1.00150 |
| Vapour Pressure | 0.0106mmHg at 25°C |
| Index of Refraction | 1.426 |
| InChIKey | MVCSJYRFFFDKCX-UHFFFAOYSA-N |
| SMILES | COC(=O)NCCC[Si](OC)(OC)OC |
|
~94%
methyl N-(3-tri... CAS#:23432-62-4 |
| Literature: General Electric Company Patent: US6673954 B1, 2004 ; Location in patent: Page column 6-9 ; |
|
~%
methyl N-(3-tri... CAS#:23432-62-4 |
| Literature: WACKER CHEMIE AG Patent: US2012/130103 A1, 2012 ; Location in patent: Page/Page column 4 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| METHYL [3-(TRIMETHOXYSILYL)PROPYL]CARBAMATE |
| N-(3-trimethoxysilylpropyl)methylcarbamate |
| N-[(3-(trimethoxysilyl)prop-1-yl)]-O-methylcarbamate |
| methylcarbamatopropyl-trimethoxysilane |
| methyl N-3-(trimethoxysilyl)propylcarbamate |