1,3,5-tris-(Trimethoxysilylpropyl)-isocyanurate structure
|
Common Name | 1,3,5-tris-(Trimethoxysilylpropyl)-isocyanurate | ||
|---|---|---|---|---|
| CAS Number | 26115-70-8 | Molecular Weight | 615.851 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 543.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H45N3O12Si3 | Melting Point | <0ºC | |
| MSDS | Chinese USA | Flash Point | 282.7±28.7 °C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
| Name | 1,3,5-tris(3-trimethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.9±45.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C21H45N3O12Si3 |
| Molecular Weight | 615.851 |
| Flash Point | 282.7±28.7 °C |
| Exact Mass | 615.231079 |
| PSA | 149.07000 |
| LogP | -1.58 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | QWOVEJBDMKHZQK-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCn1c(=O)n(CCC[Si](OC)(OC)OC)c(=O)n(CCC[Si](OC)(OC)OC)c1=O)(OC)OC |
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H331-H334-H371 |
| Precautionary Statements | P260-P284-P301 + P312 + P330-P304 + P340 + P312-P342 + P311-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R23/25 |
| Safety Phrases | 26-45 |
| RIDADR | UN 2810 |
| RTECS | XZ2025000 |
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[3-(trimethoxysilyl)propyl]- |
| 1,3,5-tris[3-(trimethoxysilyl)propyl]isocyanurate |
| Tris[3-(trimethoxysilyl)propyl] isocyanurate |
| 1,3,5-tris[3-(trimethoxysilyl)propyl]-1,3,5-triazine-2,4,6(1H,3H,5H)-trione |
| MFCD00054746 |
| 1,3,5-Tris[3-(trimethoxysilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| tris-(trimethoxysilylpropyl)isocyanurate |
| EINECS 247-465-8 |
| 1,3,5-tris-(3-trimethoxysilanyl-propyl)-[1,3,5]triazinane-2,4,6-trione |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-tris[3-(trimethoxysilyl)propyl] |